Introduction：Basic information about CAS 9011-07-8|ethenyl acetate,furan-2,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethenyl acetate,furan-2,5-dione |
|---|
| CAS Number | 9011-07-8 | Molecular Weight | 184.14600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H8O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethenyl acetate,furan-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H8O5 |
|---|
| Molecular Weight | 184.14600 |
|---|
| Exact Mass | 184.03700 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 0.31900 |
|---|
| InChIKey | KRWWZDVIEFSIOT-UHFFFAOYSA-N |
|---|
| SMILES | C=COC(C)=O.O=C1C=CC(=O)O1 |
|---|
Synonyms
| Acetic acid ethenyl ester,polymer with 2,5-furandione |
| Acetic acid ethenyl ester,5-furandione |
| ethenyl acetate-furan-2,5-dione(1:1) |
