Introduction：Basic information about CAS 1174-72-7|Tetraphenyl orthosilicate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetraphenyl orthosilicate |
|---|
| CAS Number | 1174-72-7 | Molecular Weight | 400.499 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 467.3±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H20O4Si | Melting Point | 47-50ºC |
|---|
| MSDS | / | Flash Point | 160.4±23.1 °C |
|---|
Names
| Name | tetraphenyl silicate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 467.3±18.0 °C at 760 mmHg |
|---|
| Melting Point | 47-50ºC |
|---|
| Molecular Formula | C24H20O4Si |
|---|
| Molecular Weight | 400.499 |
|---|
| Flash Point | 160.4±23.1 °C |
|---|
| Exact Mass | 400.113098 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 9.98 |
|---|
| Appearance of Characters | solid |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | ADLSSRLDGACTEX-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(O[Si](Oc2ccccc2)(Oc2ccccc2)Oc2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3261 8/PG 3 |
|---|
| HS Code | 2920909090 |
|---|
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Silane,tetraphenoxy |
| tetraphenoxy-silane |
| EINECS 214-638-4 |
| silicic acid tetraphenyl ester |
| Kieselsaeure-tetraphenylester |
| Tetraphenoxysilane |
| Silicic acid (HSiO), tetraphenyl ester |
| tetraphenylorthosilicate |
| Tetraphenoxy-monosilan |
| Tetraphenoxy-silan |
