Introduction：Basic information about CAS 59353-62-7|1H-Isoindole-1,3(2H)-dione,2-(4-bromopentyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Isoindole-1,3(2H)-dione,2-(4-bromopentyl)- |
|---|
| CAS Number | 59353-62-7 | Molecular Weight | 296.16000 |
|---|
| Density | 1.457g/cm3 | Boiling Point | 386.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.6ºC |
|---|
Names
| Name | 2-(4-bromopentyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.457g/cm3 |
|---|
| Boiling Point | 386.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14BrNO2 |
|---|
| Molecular Weight | 296.16000 |
|---|
| Flash Point | 187.6ºC |
|---|
| Exact Mass | 295.02100 |
|---|
| PSA | 37.38000 |
|---|
| LogP | 2.78410 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | BSLLSMVCLJZMHT-UHFFFAOYSA-N |
|---|
| SMILES | CC(Br)CCCN1C(=O)c2ccccc2C1=O |
|---|
Synonyms
| 4-bromo-1-phthalimidopentane |
| 2-bromo-5-phthalimidopentane |
