Introduction：Basic information about CAS 5406-21-3|Benzoic acid,2-[[(3-chlorophenyl)amino]carbonyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,2-[[(3-chlorophenyl)amino]carbonyl]- |
|---|
| CAS Number | 5406-21-3 | Molecular Weight | 275.68700 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 383.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H10ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.5ºC |
|---|
Names
| Name | 2-[(3-chlorophenyl)carbamoyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 383.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H10ClNO3 |
|---|
| Molecular Weight | 275.68700 |
|---|
| Flash Point | 185.5ºC |
|---|
| Exact Mass | 275.03500 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 3.36350 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | XSSZPZGQMKGAKN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)Nc1cccc(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| benzoic acid,2-[[(3-chlorophenyl)amino]carbonyl] |
| N-<3-Chlor-phenyl>-phtalaminsaeure |
| 2-[N-(3-chlorophenyl)carbamoyl]benzoic acid |
| m-Chlorphenyl-N-phthalaminsaeure |
| F0777-0906 |
| N-(3-Chlor-phenyl)-phthalamidsaeure |
| Phthalsaeure-mono-(3-chlor-anilid) |
| 2-[(3-chlorophenyl)aminocarbonyl]benzoic acid |
| N-(3-chloro-phenyl)-phthalamic acid |
