Introduction:Basic information about CAS 30388-44-4|N-Methyl-N-[4-(methylsulfonyl)-2-nitrophenyl]amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Methyl-N-[4-(methylsulfonyl)-2-nitrophenyl]amine |
|---|
| CAS Number | 30388-44-4 | Molecular Weight | 230.24100 |
|---|
| Density | 1.416 g/cm3 | Boiling Point | 441.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O4S | Melting Point | 99-102ºC |
|---|
| MSDS | / | Flash Point | 220.9ºC |
|---|
Names
| Name | N-Methyl-N-[4-(methylsulfonyl)-2-nitrophenyl]amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.416 g/cm3 |
|---|
| Boiling Point | 441.6ºC at 760 mmHg |
|---|
| Melting Point | 99-102ºC |
|---|
| Molecular Formula | C8H10N2O4S |
|---|
| Molecular Weight | 230.24100 |
|---|
| Flash Point | 220.9ºC |
|---|
| Exact Mass | 230.03600 |
|---|
| PSA | 100.37000 |
|---|
| LogP | 2.71700 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | SGWXKSCZDKMSLI-UHFFFAOYSA-N |
|---|
| SMILES | CNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-mesyl-N-methyl-2-nitroaniline |
| 4-Methyl Sulfonyl-N-Methyl-2-Nitro Aniline |
| methyl 4-methyl-amino-3-nitrophenyl sulfone |
| 4-methanesulfonyl-N-methyl-2-nitro-aniline |
| 4-Methansulfonyl-N-methyl-2-nitro-anilin |
| Methyl-<3-nitro-4-methylamino-phenyl>-sulfon |
| N-Methyl-4-methylsulfonyl-2-nitrobenzenamine |
| 3-nitro-4-methylaminophenyl methyl sulfone |