Introduction：Basic information about CAS 67154-42-1|1H-PYRROLE-2,5-DIONE, 1-(2,4-DIMETHOXYPHENYL)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-PYRROLE-2,5-DIONE, 1-(2,4-DIMETHOXYPHENYL)- |
|---|
| CAS Number | 67154-42-1 | Molecular Weight | 233.22000 |
|---|
| Density | 1.308g/cm3 | Boiling Point | 404.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.2ºC |
|---|
Names
| Name | 1-(2,4-dimethoxyphenyl)pyrrole-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.308g/cm3 |
|---|
| Boiling Point | 404.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO4 |
|---|
| Molecular Weight | 233.22000 |
|---|
| Flash Point | 198.2ºC |
|---|
| Exact Mass | 233.06900 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 1.19820 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | FZOPHURHMRGGIY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N2C(=O)C=CC2=O)c(OC)c1 |
|---|
Synonyms
| F1383-0003 |
| N-(2,4-dimethoxyphenyl)maleimide |
| 1-(2,4-dimethoxy-phenyl)-pyrrole-2,5-dione |
| 1-(2,4-dimethoxyphenyl)-1H-pyrrole-2,5-dione |
| 1-(2,4-dimethoxyphenyl)azoline-2,5-dione |
