Introduction：Basic information about CAS 19201-53-7|6,6'-Dibromindigo, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,6'-Dibromindigo |
|---|
| CAS Number | 19201-53-7 | Molecular Weight | 420.05500 |
|---|
| Density | 1.932g/cm3 | Boiling Point | 486ºC at 760mmHg |
|---|
| Molecular Formula | C16H8Br2N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.7ºC |
|---|
Names
| Name | 6,6'-dibromo-2,2'-biindole-3,3'(1H,1'H)-dione (en) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.932g/cm3 |
|---|
| Boiling Point | 486ºC at 760mmHg |
|---|
| Molecular Formula | C16H8Br2N2O2 |
|---|
| Molecular Weight | 420.05500 |
|---|
| Flash Point | 247.7ºC |
|---|
| Exact Mass | 417.89500 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 4.61580 |
|---|
| Vapour Pressure | 1.35E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.739 |
|---|
| InChIKey | UOZOCOQLYQNHII-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C(c2[nH]c3cc(Br)ccc3c2O)=Nc2cc(Br)ccc21 |
|---|
Synonyms
| Purple of the Ancients |
| Tyrian purple |
| Royal purple |
| C.I. Natural Violet 1 |
| 6,6'-dibromo-indigotin |
| 6,6'-DibroMoindigo |
| 6,6'-Dibromindigo |
