Introduction：Basic information about CAS 142434-81-9|4-Phosphonomethyl-L-Phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Phosphonomethyl-L-Phenylalanine |
|---|
| CAS Number | 142434-81-9 | Molecular Weight | 259.19600 |
|---|
| Density | 1.499g/cm3 | Boiling Point | 544.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H14NO5P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.2ºC |
|---|
Names
| Name | 4-Phosphonomethyl-L-Phenylalanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.499g/cm3 |
|---|
| Boiling Point | 544.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H14NO5P |
|---|
| Molecular Weight | 259.19600 |
|---|
| Flash Point | 283.2ºC |
|---|
| Exact Mass | 259.06100 |
|---|
| PSA | 130.66000 |
|---|
| LogP | 1.01900 |
|---|
| Vapour Pressure | 1.07E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | SAQLLHDEEMZENJ-VIFPVBQESA-N |
|---|
| SMILES | NC(Cc1ccc(CP(=O)(O)O)cc1)C(=O)O |
|---|
Synonyms
| p-pheylcyclohexylmethylenecyclopropane |
| p-phosphonomethyl-L-phenylalanine |
| 4-phenylcyclohexylidenecyclopropane |
| Phosphonomethyltyrosine |
| 4-phosphonomethylphenylalanine |
| p-phenylcyclohexylidenecyclopropane |
