Introduction：Basic information about CAS 142508-07-4|(1s,2r)-2-(isopropylamino)-1,2-diphenylethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1s,2r)-2-(isopropylamino)-1,2-diphenylethanol |
|---|
| CAS Number | 142508-07-4 | Molecular Weight | 255.35500 |
|---|
| Density | 1.061g/cm3 | Boiling Point | 378.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 98.2ºC |
|---|
Names
| Name | (1s,2r)-2-(isopropylamino)-1,2-diphenylethanol |
|---|
Chemical & Physical Properties
| Density | 1.061g/cm3 |
|---|
| Boiling Point | 378.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO |
|---|
| Molecular Weight | 255.35500 |
|---|
| Flash Point | 98.2ºC |
|---|
| Exact Mass | 255.16200 |
|---|
| PSA | 32.26000 |
|---|
| LogP | 3.85020 |
|---|
| Vapour Pressure | 2.17E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | ILABSMRKFLZNPK-SJORKVTESA-N |
|---|
| SMILES | CC(C)NC(c1ccccc1)C(O)c1ccccc1 |
|---|
