Introduction：Basic information about CAS 144538-22-7|(5S,6R)-5,6-Diphenylmorpholin-2-on, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5S,6R)-5,6-Diphenylmorpholin-2-on |
|---|
| CAS Number | 144538-22-7 | Molecular Weight | 253.296 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 444.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.3±28.7 °C |
|---|
Names
| Name | (5S,6R)-5,6-Diphenyl-2-morpholinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 444.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H15NO2 |
|---|
| Molecular Weight | 253.296 |
|---|
| Flash Point | 222.3±28.7 °C |
|---|
| Exact Mass | 253.110275 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 2.22 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | LTPOSIZJPSDSIL-JKSUJKDBSA-N |
|---|
| SMILES | O=C1CNC(c2ccccc2)C(c2ccccc2)O1 |
|---|
Synonyms
| 2-Morpholinone, 5,6-diphenyl-, (5S,6R)- |
| (5S,6R)-5,6-Diphenylmorpholin-2-on |
| (5S,6R)-5,6-Diphenylmorpholin-2-one |
| (5S,6R)-5,6-Diphenyl-2-morpholinone |
