Introduction:Basic information about CAS 14575-84-9|D-3-Bromocamphor-8-sulfonic acid ammonium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-3-Bromocamphor-8-sulfonic acid ammonium salt |
|---|
| CAS Number | 14575-84-9 | Molecular Weight | 328.223 |
|---|
| Density | / | Boiling Point | 477.5ºC at 760mmHg |
|---|
| Molecular Formula | C10H18BrNO4S | Melting Point | 284-285ºC (dec.) |
|---|
| MSDS | ChineseUSA | Flash Point | 242.6ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | [(1R)-(endo,anti)]-(+)-3-Bromocamphor-8-sulfonic acid ammonium salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 477.5ºC at 760mmHg |
|---|
| Melting Point | 284-285ºC (dec.) |
|---|
| Molecular Formula | C10H18BrNO4S |
|---|
| Molecular Weight | 328.223 |
|---|
| Flash Point | 242.6ºC |
|---|
| Exact Mass | 327.013977 |
|---|
| PSA | 83.06000 |
|---|
| LogP | 3.04770 |
|---|
| InChIKey | GFBVBBRNPGPROZ-ATNBVHDLSA-N |
|---|
| SMILES | CC12CCC(C(Br)C1=O)C2(C)CS(=O)(=O)O.N |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| MFCD00167438 |
| Bicyclo[2.2.1]heptane-7-methanesulfonic acid, 3-bromo-1,7-dimethyl-2-oxo-, ammonium salt, (1R,3S,4S,7R)- |
| Ammonium,(1R,3S,4S,7R)-3-bromo-1,7-dimethyl-2-oxobicyclo[2.2.1]heptan-7-yl)methanesulfonate |
| [(1R,3S,4S,7R)-3-Bromo-1,7-dimethyl-2-oxobicyclo[2.2.1]hept-7-yl]methanesulfonic acid ammoniate |
| EINECS 238-616-9 |
| [(1R)-(endo,anti)]-(+)-3-Bromocamphor-8-sulfonic acid ammonium salt |
| (+)-3-Bromocamphor-8-sulfonic Acid Ammonium Salt |
| [(1R,3S,4S,7R)-3-Bromo-1,7-dimethyl-2-oxobicyclo[2.2.1]hept-7-yl]methanesulfonic acid ammoniate (1:1) |
| D-3-Bromocamphor-8-sulfonic acid ammonium salt |