Introduction：Basic information about CAS 146924-94-9|(+)-3-Hydroxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (+)-3-Hydroxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|
| CAS Number | 146924-94-9 | Molecular Weight | 269.29500 |
|---|
| Density | 1.295 | Boiling Point | 551.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO3 | Melting Point | 196-197ºC |
|---|
| MSDS | / | Flash Point | 287.2ºC |
|---|
Names
| Name | 3-hydroxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|
Chemical & Physical Properties
| Density | 1.295 |
|---|
| Boiling Point | 551.3ºC at 760 mmHg |
|---|
| Melting Point | 196-197ºC |
|---|
| Molecular Formula | C16H15NO3 |
|---|
| Molecular Weight | 269.29500 |
|---|
| Flash Point | 287.2ºC |
|---|
| Exact Mass | 269.10500 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 2.20900 |
|---|
| Vapour Pressure | 5.47E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | FTOHXQPVCMMHRO-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N2C(=O)C(O)C2c2ccccc2)cc1 |
|---|
