Introduction：Basic information about CAS 84278-00-2|2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose |
|---|
| CAS Number | 84278-00-2 | Molecular Weight | 373.31500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H19N3O9 | Melting Point | 113-114°C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07, GHS08 | Signal Word | Warning |
|---|
Names
| Name | [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-azidooxan-2-yl]methyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 113-114°C |
|---|
| Molecular Formula | C14H19N3O9 |
|---|
| Molecular Weight | 373.31500 |
|---|
| Exact Mass | 373.11200 |
|---|
| PSA | 164.18000 |
|---|
| InChIKey | QKGHBQJLEHAMKJ-RQICVUQASA-N |
|---|
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(N=[N+]=[N-])C(OC(C)=O)C1OC(C)=O |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Symbol |
GHS07, GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335-H341 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/21/22-36/37/38-68 |
|---|
| Safety Phrases | 26-36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactose |
| D-Galactopyranose,2-azido-2-deoxy-,1,3,4,6-tetraacetate |
| (3R,4R,5R,6R)-6-(acetoxymethyl)-3-azidotetrahydro-2H-pyran-2,4,5-triyl triacetate |
| peracetyl 2-azido-2-deoxygalactoside |
| 2-deoxy-2-azido-1,3,4,6-tetra-O-acetyl-D-galactopyranoside |
| 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose |
| 1,3,4,6-tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranoside |
| 2-Azido-2-deoxy-3,4,6-tri-O-acetyl-D-galactopyranosyl acetate |
| 3,4,6-tri-O-acetyl-2-azido-2-deoxy-D-galactopyranosyl acetate |
| 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranose |
| 2-Azido-2-deoxy-D-galactopyranose 1,3,4,6-Tetraacetate |
| 2-Azido-D-galactose tetraacetate |
