Introduction：Basic information about CAS 85317-52-8|4-nitro-phenylalanine methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-nitro-phenylalanine methyl ester |
|---|
| CAS Number | 85317-52-8 | Molecular Weight | 224.21300 |
|---|
| Density | 1.283g/cm3 | Boiling Point | 360ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.5ºC |
|---|
Names
| Name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.283g/cm3 |
|---|
| Boiling Point | 360ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O4 |
|---|
| Molecular Weight | 224.21300 |
|---|
| Flash Point | 171.5ºC |
|---|
| Exact Mass | 224.08000 |
|---|
| PSA | 98.14000 |
|---|
| LogP | 1.86110 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | FUFUQQWIXMPZFU-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(N)Cc1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| H-Phe(4-NO2)-OMeHCl |
| p-nitro-phenylalanine methyl ester |
| methyl 2-amino-3-(4-nitrophenyl)propionate |
| 4-nitro-phenylalanine methyl ester |
| 4-Nitro-phenylalanin-methylester |
| methyl 2-amino-3-(4-nitrophenyl)propanoate |
| (S)-Methyl 2-amino-3-(4-nitrophenyl)propanoate |
