Introduction：Basic information about CAS 862372-86-9|(R)-3,3-DIMETHYL-1,1-BINAPHTHALENE-2,2-DIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-3,3-DIMETHYL-1,1-BINAPHTHALENE-2,2-DIOL |
|---|
| CAS Number | 862372-86-9 | Molecular Weight | 244.28700 |
|---|
| Density | 1.203 g/cm3 | Boiling Point | 380.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H20N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.7ºC |
|---|
Names
| Name | (3R)-3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.203 g/cm3 |
|---|
| Boiling Point | 380.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H20N2O4 |
|---|
| Molecular Weight | 244.28700 |
|---|
| Flash Point | 183.7ºC |
|---|
| Exact Mass | 244.14200 |
|---|
| PSA | 92.86000 |
|---|
| LogP | 1.43760 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | OSYGMOYBKKZJES-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC(N)(C(=O)O)C1 |
|---|
Synonyms
| (r)-3-amino-1-(tert-butoxycarbonyl)piperidine-3-carboxylic acid |
