Introduction：Basic information about CAS 86273-18-9|lenampicillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | lenampicillin |
|---|
| CAS Number | 86273-18-9 | Molecular Weight | 461.48800 |
|---|
| Density | 1.47g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C21H23N3O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Molecular Formula | C21H23N3O7S |
|---|
| Molecular Weight | 461.48800 |
|---|
| Exact Mass | 461.12600 |
|---|
| PSA | 170.38000 |
|---|
| LogP | 1.86060 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | ZKUKMWMSYCIYRD-ZXFNITATSA-N |
|---|
| SMILES | Cc1oc(=O)oc1COC(=O)C1N2C(=O)C(NC(=O)C(N)c3ccccc3)C2SC1(C)C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
Synonyms
| Lenampicilina |
| LAPC |
| Lenampicillinum [Latin] |
| Lenampicillin |
| Lenampicillinum |
| Lenampicilline |
| Lenampicilina [Spanish] |
| Lenampicillin (INN) |
| Lenampicilline [French] |
