Introduction：Basic information about CAS 86392-75-8|7-Deaza-2'-deoxyguanosine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Deaza-2'-deoxyguanosine |
|---|
| CAS Number | 86392-75-8 | Molecular Weight | 266.253 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 621.4±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14N4O4 | Melting Point | 262-265 °C |
|---|
| MSDS | / | Flash Point | 329.6±34.3 °C |
|---|
Names
| Name | 1,4-dichloro-2-methyl-5-propan-2-ylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 621.4±65.0 °C at 760 mmHg |
|---|
| Melting Point | 262-265 °C |
|---|
| Molecular Formula | C11H14N4O4 |
|---|
| Molecular Weight | 266.253 |
|---|
| Flash Point | 329.6±34.3 °C |
|---|
| Exact Mass | 266.101501 |
|---|
| PSA | 126.39000 |
|---|
| LogP | -0.68 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.834 |
|---|
| InChIKey | PFCLMNDDPTZJHQ-XLPZGREQSA-N |
|---|
| SMILES | Nc1nc2c(ccn2C2CC(O)C(CO)O2)c(=O)[nH]1 |
|---|
Synonyms
| 2'-deoxy-7-deazaguanosine |
| Benzene,1,4-dichloro-2-methyl-5-(1-methylethyl) |
| 2-Amino-7-(2-deoxy-β-D-erythro-pentofuranosyl)-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
| 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-7-(2-deoxy-β-D-erythro-pentofuranosyl)-1,7-dihydro- |
| 7-deaza-2'-deoxyguanosine |
