Introduction：Basic information about CAS 86487-17-4|Tributyl(2-methoxyphenyl)stannane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tributyl(2-methoxyphenyl)stannane |
|---|
| CAS Number | 86487-17-4 | Molecular Weight | 397.17400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H34OSn | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | tributyl-(2-methoxyphenyl)stannane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H34OSn |
|---|
| Molecular Weight | 397.17400 |
|---|
| Exact Mass | 398.16300 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 5.75130 |
|---|
| InChIKey | OSIQUECDJCZFED-UHFFFAOYSA-N |
|---|
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1OC |
|---|
Safety Information
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-MeOC6H4Sn(n-Bu)3 |
| Stannane,tributyl(2-methoxyphenyl) |
| OR0595 |
| (2-methoxyphenyl)-tributylstannane |
| o-CH3OC6H4SnBu3 |
| o-MeOC6H4SnBu3 |
| 2-Methoxy(tri-n-butylstannyl)benzene |
| 2-methoxyphenyltributyltin |
| o-methoxyphenyltributyltin |
| tributyl (2-methoxyphenyl)stannane |
