Introduction：Basic information about CAS 70402-14-1|6-AMINO-1-PHENALENONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-AMINO-1-PHENALENONE |
|---|
| CAS Number | 70402-14-1 | Molecular Weight | 195.21700 |
|---|
| Density | 1.349g/cm3 | Boiling Point | 421.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9NO | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 208.9ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 6-aminophenalen-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.349g/cm3 |
|---|
| Boiling Point | 421.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9NO |
|---|
| Molecular Weight | 195.21700 |
|---|
| Flash Point | 208.9ºC |
|---|
| Exact Mass | 195.06800 |
|---|
| PSA | 43.09000 |
|---|
| LogP | 3.21270 |
|---|
| Index of Refraction | 1.771 |
|---|
| InChIKey | LNWQVXDBQBAGHD-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c3c(cccc13)C(=O)C=C2 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 6-amino-1H-phenalene-1-one |
| 6-azanylphenalen-1-one |
| 6-Amino-1H-phenalen-1-one |
| 6-Amino-1-phenalenone |
| 6-Aminophenalenon |
| 6-aminophenalenone |
| 6-aminophenalemine |
