Introduction:Basic information about CAS 53518-14-2|Coumarin 152, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Coumarin 152 |
|---|
| CAS Number | 53518-14-2 | Molecular Weight | 257.208 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 323.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10F3NO2 | Melting Point | 147-149ºC |
|---|
| MSDS | / | Flash Point | 149.6±27.9 °C |
|---|
Names
| Name | coumarin 152 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 323.7±42.0 °C at 760 mmHg |
|---|
| Melting Point | 147-149ºC |
|---|
| Molecular Formula | C12H10F3NO2 |
|---|
| Molecular Weight | 257.208 |
|---|
| Flash Point | 149.6±27.9 °C |
|---|
| Exact Mass | 257.066376 |
|---|
| PSA | 33.45000 |
|---|
| LogP | 3.60 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | KDTAEYOYAZPLIC-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932209090 |
|---|
Customs
| HS Code | 2932209090 |
|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2H-1-Benzopyran-2-one,7-(dimethylamino)-4-(trifluoromethyl) |
| EINECS 258-598-6 |
| coumarin-152 |
| 7-NMe2-4-CF3-coumarin |
| Coumarin 152 |
| 7-(Dimethylamino)-4-(trifluoromethyl)-2H-chromen-2-one |
| 7-(Dimethylamino)-4-(trifluoromethyl)coumarin |
| coumarin 485 |
| 7-(dimethylamino)-4-(trifluoromethyl)chromen-2-one |
| 2H-1-Benzopyran-2-one, 7-(dimethylamino)-4-(trifluoromethyl)- |
| 7-N,N-dimethylamino-4-trifluoromethyl-1,2-benzopyrone |