Introduction：Basic information about CAS 14379-00-1|Croconic acid disodium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Croconic acid disodium salt |
|---|
| CAS Number | 14379-00-1 | Molecular Weight | 186.03000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C5Na2O5 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | disodium,3,4,5-trioxocyclopentene-1,2-diolate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C5Na2O5 |
|---|
| Molecular Weight | 186.03000 |
|---|
| Exact Mass | 185.95400 |
|---|
| PSA | 97.33000 |
|---|
| InChIKey | OQXLFPHHAAAVKQ-UHFFFAOYSA-L |
|---|
| SMILES | O=c1c([O-])c([O-])c(=O)c1=O.[Na+].[Na+] |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| disodium(4,5-dihydroxycyclopent-4-ene-1,2,3-trionate(-2H)) |
| MFCD00191954 |
| Croconic acid,disodium deriv. (6CI) |
| Sodium croconate |
| Sodium,[(3,4,5-trioxo-1-cyclopenten-1,2-ylene)dioxy]di-(7CI) |
| 4-Cyclopentene-1,2,3-trione,4,5-dihydroxy-,disodium salt (8CI,9CI) |
| Croconic acid disodium salt |
| 4,5-Dihydroxy-4-cyclopentene-1,2,3-trione disodium salt |
| disodium croconate |
