Introduction:Basic information about CAS 870281-86-0|(S)-2-(1-aminopropyl)-5-fluoro-3-phenylquinazolin-4(3H)-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-2-(1-aminopropyl)-5-fluoro-3-phenylquinazolin-4(3H)-one |
|---|
| CAS Number | 870281-86-0 | Molecular Weight | 297.327 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 455.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16FN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.1±31.5 °C |
|---|
Names
| Name | 2-[(1S)-1-Aminopropyl]-5-fluoro-3-phenyl-4(3H)-quinazolinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 455.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16FN3O |
|---|
| Molecular Weight | 297.327 |
|---|
| Flash Point | 229.1±31.5 °C |
|---|
| Exact Mass | 297.127747 |
|---|
| PSA | 60.91000 |
|---|
| LogP | 2.23 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | BNMGOWXQUZHWIO-ZDUSSCGKSA-N |
|---|
| SMILES | CCC(N)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
|---|
Synonyms
| 2-[(1S)-1-Aminopropyl]-5-fluoro-3-phenyl-4(3H)-quinazolinone |
| 4(3H)-Quinazolinone, 2-[(1S)-1-aminopropyl]-5-fluoro-3-phenyl- |
| (S)-2-(1-aminoethyl)-6-methylphenol |
| Phenol,2-(1-aminoethyl)-6-methyl-,(S)-(9CI) |
| 2-(1-aMinoethyl)-6-Methyl |
| (S)-2-(1-amino-propyl)-5-fluoro-3-phenyl-3H-quinazolin-4-one |
| (S)-2-(1-aMinopropyl)-5-fluoro-3-phenylquinazolin-4(3H)-one |