Introduction:Basic information about CAS 1152501-92-2|2,6-Difluoro-3-(propylsulfonyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Difluoro-3-(propylsulfonyl)benzoic acid |
|---|
| CAS Number | 1152501-92-2 | Molecular Weight | 264.246 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 430.5±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10F2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 214.2±28.7 °C |
|---|
Names
| Name | 2,6-difluoro-3-propylsulfonylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 430.5±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10F2O4S |
|---|
| Molecular Weight | 264.246 |
|---|
| Flash Point | 214.2±28.7 °C |
|---|
| Exact Mass | 264.026794 |
|---|
| PSA | 79.82000 |
|---|
| LogP | 1.62 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.516 |
|---|
| InChIKey | PEZDPTPWOADZPM-UHFFFAOYSA-N |
|---|
| SMILES | CCCS(=O)(=O)c1ccc(F)c(C(=O)O)c1F |
|---|
Synonyms
| Benzoic acid, 2,6-difluoro-3-(propylsulfonyl)- |
| 2,6-Difluoro-3-(propylsulfonyl)benzoic acid |