Introduction：Basic information about CAS 15862-01-8|2-Methoxy-4-nitrobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methoxy-4-nitrobiphenyl |
|---|
| CAS Number | 15862-01-8 | Molecular Weight | 229.231 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 349.6±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.1±24.3 °C |
|---|
Names
| Name | 2-methoxy-4-nitro-1-phenylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 349.6±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H11NO3 |
|---|
| Molecular Weight | 229.231 |
|---|
| Flash Point | 152.1±24.3 °C |
|---|
| Exact Mass | 229.073898 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.56 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | ZWZJLJMULXIMLU-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccccc1 |
|---|
Synonyms
| 2-Methoxy-4-nitrobiphenyl |
| Methyl 4-nitrobiphenyl-2-yl ether |
| 1,1'-Biphenyl, 2-methoxy-4-nitro- |
| 1,1'-Biphenyl,2-methoxy-4-nitro |
| 5-nitro 2-phenyl anisole |
| 4-nitro-2-methoxybiphenyle |
