Introduction：Basic information about CAS 21427-61-2|5-chloro-3-nitropyridin-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-chloro-3-nitropyridin-2-ol |
|---|
| CAS Number | 21427-61-2 | Molecular Weight | 174.542 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 316.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H3ClN2O3 | Melting Point | 234 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 144.9±26.5 °C |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 5-chloro-3-nitro-1H-pyridin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 316.0±37.0 °C at 760 mmHg |
|---|
| Melting Point | 234 °C |
|---|
| Molecular Formula | C5H3ClN2O3 |
|---|
| Molecular Weight | 174.542 |
|---|
| Flash Point | 144.9±26.5 °C |
|---|
| Exact Mass | 173.983215 |
|---|
| PSA | 78.94000 |
|---|
| LogP | 0.98 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | QVGQNICXNZMXQA-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]cc(Cl)cc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22;R37/38;R41 |
|---|
| Safety Phrases | S26-S36/37/39-S39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 5-chloro-3-nitro-2-hydroxypyridine |
| 5-Chloro-2-hydroxy-3-nitropyridine |
| MFCD00114884 |
| 2-pyridinol, 5-chloro-3-nitro- |
| 5-Chlor-3-nitro-pyridin-2-ol |
| 5-Chloro-3-Nitro-2-Pyridinol |
| 2-Hydroxy-3-nitro-5-chloropyridine |
| 5-Chloro-3-nitro-2(1H)-pyridinone |
| 5-chloro-3-nitropyridin-2-ol |
