Introduction:Basic information about CAS 1141-06-6|alpha-pyridoin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | alpha-pyridoin |
|---|
| CAS Number | 1141-06-6 | Molecular Weight | 214.22000 |
|---|
| Density | 1.287g/cm3 | Boiling Point | 387.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H10N2O2 | Melting Point | 156-160ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 188.2ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-hydroxy-1,2-dipyridin-2-ylethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.287g/cm3 |
|---|
| Boiling Point | 387.6ºC at 760mmHg |
|---|
| Melting Point | 156-160ºC(lit.) |
|---|
| Molecular Formula | C12H10N2O2 |
|---|
| Molecular Weight | 214.22000 |
|---|
| Flash Point | 188.2ºC |
|---|
| Exact Mass | 214.07400 |
|---|
| PSA | 63.08000 |
|---|
| LogP | 1.39290 |
|---|
| Vapour Pressure | 1.06E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | ZKBDAJDDDOIASC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccn1)C(O)c1ccccn1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-hydroxy-1,2-di(pyridin-2-yl)-ethan-1-one |
| 2-hydroxy-1,2-di-pyridin-2-yl-ethanone |
| EINECS 214-526-5 |
| 2-hydroxy-[1,2-di(pyridin-2-yl)]ethane-1-one |
| 1,2-bis(2-pyridinyl)-2-hydroxyethan-1-one |
| 2-hydroxy-1,2-di(2-pyridyl)ethan-1-one |
| MFCD00010691 |
| a-pyridoin |
| Ethanone,2-hydroxy-1,2-di-2-pyridinyl |
| 2-hydroxy-1,2-(dipyridine-2-yl)ethane-1-one |