Introduction:Basic information about CAS 53731-36-5|4-[2-(3,5-Diethoxyphenoxy)ethyl]morpholine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(3,5-Diethoxyphenoxy)ethyl]morpholine |
|---|
| CAS Number | 53731-36-5 | Molecular Weight | 295.37400 |
|---|
| Density | 1.071g/cm3 | Boiling Point | 430.8ºC at 760mmHg |
|---|
| Molecular Formula | C16H25NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 126.5ºC |
|---|
Names
| Name | 4-[2-(3,5-Diethoxyphenoxy)ethyl]morpholine |
|---|
Chemical & Physical Properties
| Density | 1.071g/cm3 |
|---|
| Boiling Point | 430.8ºC at 760mmHg |
|---|
| Molecular Formula | C16H25NO4 |
|---|
| Molecular Weight | 295.37400 |
|---|
| Flash Point | 126.5ºC |
|---|
| Exact Mass | 295.17800 |
|---|
| PSA | 40.16000 |
|---|
| LogP | 2.13290 |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | MXVLJFCCQMXEEE-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc(OCC)cc(OCCN2CCOCC2)c1 |
|---|