Introduction：Basic information about CAS 2193-87-5|(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|
| CAS Number | 2193-87-5 | Molecular Weight | 390.44500 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 577.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H27FO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 302.9ºC |
|---|
Names
| Name | (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 577.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H27FO5 |
|---|
| Molecular Weight | 390.44500 |
|---|
| Flash Point | 302.9ºC |
|---|
| Exact Mass | 390.18400 |
|---|
| PSA | 94.83000 |
|---|
| LogP | 1.81580 |
|---|
| Vapour Pressure | 9.87E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | YVHXHNGGPURVOS-SBTDHBFYSA-N |
|---|
| SMILES | C=C1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO |
|---|
Synonyms
| Fluprednidene (INN) |
| Fluprednidene |
| Fluprednidenum |
| Fluprednideno |
| Fluprednidenum [INN-Latin] |
| Fluprednidene [INN:BAN] |
| UNII-FA517NS3N7 |
| Fluprednideno [INN-Spanish] |
