Introduction：Basic information about CAS 7008-14-2|Hydroxindasate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hydroxindasate |
|---|
| CAS Number | 7008-14-2 | Molecular Weight | 352.42700 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 555.1ºC at 760 mmHg |
|---|
| Molecular Formula | C21H24N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 289.5ºC |
|---|
Names
| Name | 3-(2-Aminoethyl)-1-(4-methoxybenzyl)-2-methyl-1H-indol-5-yl aceta te |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 555.1ºC at 760 mmHg |
|---|
| Molecular Formula | C21H24N2O3 |
|---|
| Molecular Weight | 352.42700 |
|---|
| Flash Point | 289.5ºC |
|---|
| Exact Mass | 352.17900 |
|---|
| PSA | 66.48000 |
|---|
| LogP | 4.13340 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | FEPRMHVEXSXGPN-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cn2c(C)c(CCN)c3cc(OC(C)=O)ccc32)cc1 |
|---|
