Introduction：Basic information about CAS 20228-27-7|Ruvazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ruvazone |
|---|
| CAS Number | 20228-27-7 | Molecular Weight | 250.25100 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 393.38°C (rough estimate) |
|---|
| Molecular Formula | C12H14N2O4 | Melting Point | 185°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2E)-2-[(2-ethoxybenzoyl)hydrazinylidene]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 393.38°C (rough estimate) |
|---|
| Melting Point | 185°C |
|---|
| Molecular Formula | C12H14N2O4 |
|---|
| Molecular Weight | 250.25100 |
|---|
| Exact Mass | 250.09500 |
|---|
| PSA | 91.48000 |
|---|
| LogP | 1.85040 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | ACONNXZOJIHEHN-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccccc1C(=O)NN=C(C)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2928000090 |
|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-Ethoxybenzoic acid (1-carboxyethylidene)hydrazide |
| Pyruvic acid,O-ethoxybenzoylhydrazone |
| o-Ethoxy-benzoyl-hydrazone of pyruvic acid |
| Ruvazon [INN-Spanish] |
| Ruvazone |
| o-Etossi-benzoil-idrazone dell'acido piruvico [Italian] |
| o-Ethoxybenzoic acid (1-carboxyethylidene)hydrazide |
| M 6/42 |
| Ruvazonum [INN-Latin] |
