Introduction：Basic information about CAS 57558-44-8|Secoverine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Secoverine |
|---|
| CAS Number | 57558-44-8 | Molecular Weight | 345.51900 |
|---|
| Density | 0.999g/cm3 | Boiling Point | 471.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H35NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.1ºC |
|---|
Names
| Name | 1-cyclohexyl-4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.999g/cm3 |
|---|
| Boiling Point | 471.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H35NO2 |
|---|
| Molecular Weight | 345.51900 |
|---|
| Flash Point | 239.1ºC |
|---|
| Exact Mass | 345.26700 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 4.87770 |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | WAVYHSURRZBQKO-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCCC(=O)C1CCCCC1)C(C)Cc1ccc(OC)cc1 |
|---|
Synonyms
| Secoverina |
| Secoverine |
| 3[N-ethyl-[1-methyl-2-(4-methoxyphenyl)]-ethylamino]-propylcyclohexylketone |
| Secoverina [INN-Spanish] |
| 1-Cyclohexyl-4-(ethyl-(1-(4-methoxyphenyl)-2-poropyl)amino)-1-butanon |
| secovorine |
| 1-Butanone,1-cyclohexyl-4-(ethyl(2-(4-methoxyphenyl)-1-methylethyl)amino) |
| Secoverinum [INN-Latin] |
