Introduction：Basic information about CAS 57645-05-3|sermetacin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sermetacin |
|---|
| CAS Number | 57645-05-3 | Molecular Weight | 444.86500 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 688.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H21ClN2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 370.3ºC |
|---|
Names
| Name | (2S)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]-3-hydroxypropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 688.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H21ClN2O6 |
|---|
| Molecular Weight | 444.86500 |
|---|
| Flash Point | 370.3ºC |
|---|
| Exact Mass | 444.10900 |
|---|
| PSA | 121.35000 |
|---|
| LogP | 3.24470 |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | AUDFHJLSHQWFQQ-SFHVURJKSA-N |
|---|
| SMILES | COc1ccc2c(c1)c(CC(=O)NC(CO)C(=O)O)c(C)n2C(=O)c1ccc(Cl)cc1 |
|---|
Synonyms
| Sermetacina [INN-Spanish] |
| Sermetacinum |
| Sermetacin (USAN/INN) |
| N-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indolylacetyl]-serine |
| Sermetacine [INN-French] |
| Sermetacinum [INN-Latin] |
| Sermetacin |
| Sermetacine |
| Sermetacina |
