Introduction:Basic information about CAS 129-57-7|Sodium diprotrizoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sodium diprotrizoate |
|---|
| CAS Number | 129-57-7 | Molecular Weight | 663.94900 |
|---|
| Density | / | Boiling Point | 623.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H12I3N2NaO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 330.8ºC |
|---|
Names
| Name | sodium,2,4,6-triiodo-3,5-bis(propanoylamino)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 623.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H12I3N2NaO4 |
|---|
| Molecular Weight | 663.94900 |
|---|
| Flash Point | 330.8ºC |
|---|
| Exact Mass | 663.78300 |
|---|
| PSA | 105.31000 |
|---|
| LogP | 5.06710 |
|---|
| Vapour Pressure | 2.1E-16mmHg at 25°C |
|---|
| InChIKey | MEMHCDLRPADYQY-UHFFFAOYSA-M |
|---|
| SMILES | CCC(=O)Nc1c(I)c(NC(=O)CC)c(I)c(C(=O)[O-])c1I.[Na+] |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Miokon sodium |
| Sodium 3,5-dipropionamido-2,4,6-triiodobenzoate |
| Diprotrizoate de sodium [INN-French] |
| Diprotrizoato sodico [INN-Spanish] |
| 2,4,6-triiodo-3,5-bis-propionylamino-benzoic acid,sodium-salt |
| 3,5-Dipropionamido-2,4,6-triiodobenzoic acid sodium salt |
| Natrii diprotrizoas [INN-Latin] |
| 2,4,6-Triiodo-3,5-dipropionamidobenzoic acid sodium salt |
| 2,4,6-Trijod-3,5-bis-propionylamino-benzoesaeure,Natrium-Salz |
| sodium 2,4,6-triiodo-3,5-bis(propionylamino)benzoate |
| Diprotrizoate sodium |
| Sodium diprotrizoate |