Introduction：Basic information about CAS 5377-23-1|3-[(2-chloroanilino)methyl]-1,3-thiazolidine-2,4-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(2-chloroanilino)methyl]-1,3-thiazolidine-2,4-dione |
|---|
| CAS Number | 5377-23-1 | Molecular Weight | 256.70900 |
|---|
| Density | 1.517g/cm3 | Boiling Point | 435.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9ClN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.3ºC |
|---|
Names
| Name | 3-[(2-chloroanilino)methyl]-1,3-thiazolidine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.517g/cm3 |
|---|
| Boiling Point | 435.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9ClN2O2S |
|---|
| Molecular Weight | 256.70900 |
|---|
| Flash Point | 217.3ºC |
|---|
| Exact Mass | 256.00700 |
|---|
| PSA | 74.71000 |
|---|
| LogP | 2.41570 |
|---|
| Index of Refraction | 1.689 |
|---|
| InChIKey | VDNJYCMYWSFCKR-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CSC(=O)N1CNc1ccccc1Cl |
|---|
Synonyms
| 6-methyl-2-propylpyridin-3-ol |
| 2-Methyl-6-propyl-pyridin-3-ol |
| CCG-7749 |
