Introduction：Basic information about CAS 111060-53-8|(S)-(+)-2-(N,N-DIBENZYLAMINO)-4-METHYLPENTANOL, 90, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(+)-2-(N,N-DIBENZYLAMINO)-4-METHYLPENTANOL, 90 |
|---|
| CAS Number | 111060-53-8 | Molecular Weight | 297.43400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H27NO | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | (2S)-2-(dibenzylamino)-4-methylpentan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H27NO |
|---|
| Molecular Weight | 297.43400 |
|---|
| Exact Mass | 297.20900 |
|---|
| PSA | 23.47000 |
|---|
| LogP | 4.09580 |
|---|
| Index of Refraction | n20/D 1.543 |
|---|
| InChIKey | FWNZCCUWXPYXDR-FQEVSTJZSA-N |
|---|
| SMILES | CC(C)CC(CO)N(Cc1ccccc1)Cc1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| N,N-dibenzyl-(S)-2-amino-4-methyl-1-pentanol |
| O032 |
| (S)-2-(DIBENZYLAMINO)-4-METHYL-1-PENTANOL |
| (S)-2-(dibenzylamino)-4-methylpentan-1-ol |
| 1-Pentanol,2-[bis(phenylmethyl)amino]-4-methyl-,(S) |
| 1-Pentanol,2-[bis(phenylmethyl)amino]-4-methyl-,(2S) |
| (S)-2-(N,N-dibenzylamino)-4-methylpentan-1-ol |
| (S)-2-(N,N-dibenzylamino)-4-methyl-1-pentanol |
| N,N-Dibenzyl-L-Leucinol |
| (S)-2-(N,N-dibenzylamino)-4-methylpentanol |
