Introduction:Basic information about CAS 114216-93-2|atalafoline B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | atalafoline B |
|---|
| CAS Number | 114216-93-2 | Molecular Weight | 317.29300 |
|---|
| Density | 1.462g/cm3 | Boiling Point | 598ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.5ºC |
|---|
Names
| Name | 1,4,5-trihydroxy-3,6-dimethoxy-10-methylacridin-9-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.462g/cm3 |
|---|
| Boiling Point | 598ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO6 |
|---|
| Molecular Weight | 317.29300 |
|---|
| Flash Point | 315.5ºC |
|---|
| Exact Mass | 317.09000 |
|---|
| PSA | 101.15000 |
|---|
| LogP | 1.82570 |
|---|
| Vapour Pressure | 6.74E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | VPIBIZOGMALERE-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(=O)c3c(O)cc(OC)c(O)c3n(C)c2c1O |
|---|
Synonyms
| N-Methyl-1,4,5-trihydroxy-3,6-dimethoxyacridine-9-one |