Introduction:Basic information about CAS 519-95-9|Florantyrone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Florantyrone |
|---|
| CAS Number | 519-95-9 | Molecular Weight | 302.32300 |
|---|
| Density | 1.367g/cm3 | Boiling Point | 574.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H14O3 | Melting Point | 184-187ºC(lit.) |
|---|
| MSDS | / | Flash Point | 315.1ºC |
|---|
Names
| Name | 4-fluoranthen-8-yl-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.367g/cm3 |
|---|
| Boiling Point | 574.2ºC at 760mmHg |
|---|
| Melting Point | 184-187ºC(lit.) |
|---|
| Molecular Formula | C20H14O3 |
|---|
| Molecular Weight | 302.32300 |
|---|
| Flash Point | 315.1ºC |
|---|
| Exact Mass | 302.09400 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 4.53470 |
|---|
| Index of Refraction | 1.786 |
|---|
| InChIKey | QOBAOSCOLAGPKI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(=O)c1ccc2c(c1)-c1cccc3cccc-2c13 |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | 28-45 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | DV1761000 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 208-279-2 |
| Cistoplex |
| Fluochol |
| Idrobil |
| 4-Oxo-4-(fluoranthrenyl-(8))-buttersaeure |
| FLORANTYRONE |
| MFCD00056701 |
| 4-fluoranthen-8-yl-4-oxo-butyric acid |
| Florantyronum |
| Fluorantyrone |
| 4-(8-fluoranthenyl)-4-oxobutyric acid |
| Florantirona |
| Florantyron |
| 4-Oxo-4-<fluoranthenyl-(8)>-buttersaeure |
| 4-Fluoranthen-8-yl-4-oxo-buttersaeure |