Introduction：Basic information about CAS 14247-78-0|6-bromo-2-(4-methoxyphenyl)-7-methyl-8H-imidazo[1,2-a]pyrimidin-5-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-bromo-2-(4-methoxyphenyl)-7-methyl-8H-imidazo[1,2-a]pyrimidin-5-one |
|---|
| CAS Number | 14247-78-0 | Molecular Weight | 334.16800 |
|---|
| Density | 1.612g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H12BrN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-bromo-2-(4-methoxyphenyl)-7-methyl-8H-imidazo[1,2-a]pyrimidin-5-one |
|---|
Chemical & Physical Properties
| Density | 1.612g/cm3 |
|---|
| Molecular Formula | C14H12BrN3O2 |
|---|
| Molecular Weight | 334.16800 |
|---|
| Exact Mass | 333.01100 |
|---|
| PSA | 59.39000 |
|---|
| LogP | 2.76910 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | YGVODHVZIKGAFL-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cn3c(=O)c(Br)c(C)[nH]c3n2)cc1 |
|---|
