Introduction：Basic information about CAS 15958-27-7|2-[(2-cyanoethyl)[p-[(p-nitrophenyl)azo]phenyl]amino]ethyl carbanilate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2-cyanoethyl)[p-[(p-nitrophenyl)azo]phenyl]amino]ethyl carbanilate |
|---|
| CAS Number | 15958-27-7 | Molecular Weight | 458.46900 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 666.9ºC at 760mmHg |
|---|
| Molecular Formula | C24H22N6O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 357.1ºC |
|---|
Names
| Name | 2-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl N-phenylcarbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 666.9ºC at 760mmHg |
|---|
| Molecular Formula | C24H22N6O4 |
|---|
| Molecular Weight | 458.46900 |
|---|
| Flash Point | 357.1ºC |
|---|
| Exact Mass | 458.17000 |
|---|
| PSA | 139.39000 |
|---|
| LogP | 6.51578 |
|---|
| Vapour Pressure | 1.19E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | TYSBKZZQBVAKMC-UHFFFAOYSA-N |
|---|
| SMILES | N#CCCN(CCOC(=O)Nc1ccccc1)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2)cc1 |
|---|
Synonyms
| Propanenitrile,3-((4-(2-(4-nitrophenyl)diazenyl)phenyl)(2-(((phenylamino)carbonyl)oxy)ethyl)amino) |
| 2-((2-cyanoethyl){p-[(p-nitrophenyl)azo]phenyl}amino)ethyl carbanilate |
| Propanenitrile,3-((4-((4-nitrophenyl)azo)phenyl)(2-(((phenylamino)carbonyl)oxy)ethyl)amino) |
| EINECS 240-090-0 |
| 4-((4-Nitrophenyl)azo)-N-(2-cyanoethyl)-N(2-(((phenylamino)carbonyl)oxy)ethyl)benzenamine |
