Introduction：Basic information about CAS 159622-09-0|(1R,2S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,2S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxylic acid methyl ester |
|---|
| CAS Number | 159622-09-0 | Molecular Weight | 241.284 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 312.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.6±27.9 °C |
|---|
Names
| Name | methyl (1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 312.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H19NO4 |
|---|
| Molecular Weight | 241.284 |
|---|
| Flash Point | 142.6±27.9 °C |
|---|
| Exact Mass | 241.131409 |
|---|
| PSA | 68.12000 |
|---|
| LogP | 2.24 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.484 |
|---|
| InChIKey | MMSKTMKTGVHMAV-PRHODGIISA-N |
|---|
| SMILES | C=CC1CC1(NC(=O)OC(C)(C)C)C(=O)OC |
|---|
Synonyms
| N-Boc-(1R,2S)-1-amino-2-vinylcyclopropane carboxylic acid methyl ester |
| (1R,2S)-methyl 1-t-butoxycarbonylamino-2-vinylcyclopropane carboxylate |
| CYC032 |
| N-Boc-vinyl-ACCA-OMe |
| (1R,2S)-1-tert-butoxycarbonylamino-2-vinyl-cyclopropanecarboxylic acid methyl ester |
| Cyclopropanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-2-ethenyl-, methyl ester, (1R,2S)- |
| (1R,2S)-ethyl 1-[(tert-butoxycarbonyl)amino]-2-ethenylcyclopropanecarboxylate |
| (1R,2S)-Methyl 1-((tert-butoxycarbonyl)amino)-2-vinylcyclopropanecarboxylate |
| methyl (1R,2S)-1-[(tert-butoxycarbonyl)amino]-2-vinylcyclopropanecarboxylate |
| Methyl-(1R,2S)-1-[(tert-butoxycarbonyl)amino]-2-vinylcyclopropancarboxylat |
| Methyl (1R,2S)-1-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-2-vinylcyclopropanecarboxylate |
| (1R,2S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxylic acid methyl ester |
