Introduction：Basic information about CAS 19649-68-4|3-[p-[(2-chloro-4-nitrophenyl)azo]-N-phenethylanilino]propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[p-[(2-chloro-4-nitrophenyl)azo]-N-phenethylanilino]propiononitrile |
|---|
| CAS Number | 19649-68-4 | Molecular Weight | 433.89000 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 656.5ºC at 760mmHg |
|---|
| Molecular Formula | C23H20ClN5O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 350.8ºC |
|---|
Names
| Name | 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-phenylethyl)anilino]propanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 656.5ºC at 760mmHg |
|---|
| Molecular Formula | C23H20ClN5O2 |
|---|
| Molecular Weight | 433.89000 |
|---|
| Flash Point | 350.8ºC |
|---|
| Exact Mass | 433.13100 |
|---|
| PSA | 97.57000 |
|---|
| LogP | 7.14958 |
|---|
| Vapour Pressure | 4.13E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | VIVXNXDTARWBMT-UHFFFAOYSA-N |
|---|
| SMILES | N#CCCN(CCc1ccccc1)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2Cl)cc1 |
|---|
Synonyms
| Propanenitrile,3-((4-(2-(2-chloro-4-nitrophenyl)diazenyl)phenyl)(2-phenylethyl)amino) |
| EINECS 243-202-6 |
| 3-(p-((2-Chloro-4-nitrophenyl)azo)-N-phenethylanilino)propiononitrile |
| 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-phenethylanilino]propanenitrile |
| 3-[{4-[(E)-(2-chloro-4-nitrophenyl)diazenyl]phenyl}(2-phenylethyl)amino]propanenitrile |
| Propanenitrile,3-((4-((2-chloro-4-nitrophenyl)azo)phenyl)(2-phenylethyl)amino) |
