Introduction:Basic information about CAS 4251-21-2|p-Phenylenedipropionic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Phenylenedipropionic Acid |
|---|
| CAS Number | 4251-21-2 | Molecular Weight | 222.23700 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 423.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O4 | Melting Point | 231-234 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 224.3ºC |
|---|
Names
| Name | 3-[4-(2-carboxyethyl)phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 423.8ºC at 760mmHg |
|---|
| Melting Point | 231-234 °C(lit.) |
|---|
| Molecular Formula | C12H14O4 |
|---|
| Molecular Weight | 222.23700 |
|---|
| Flash Point | 224.3ºC |
|---|
| Exact Mass | 222.08900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.72100 |
|---|
| InChIKey | DFOCUWFSRVQSNI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCc1ccc(CCC(=O)O)cc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| p-benzenedipropanoic acid |
| p-Phenylenedipropionic acid |
| MFCD00002779 |
| 3,3'-p-phenylene-di-propionic acid |
| 1,4-Benzenedipropanoicacid |
| 1,4-benzenediacrylic acid |
| 3,3'-p-Phenylen-di-propionsaeure |
| EINECS 224-215-6 |
| 1,4-Phenylenedipropionic acid |