Introduction：Basic information about CAS 7333-63-3|(4-Bromobutyl)(triphenyl)phosphonium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Bromobutyl)(triphenyl)phosphonium bromide |
|---|
| CAS Number | 7333-63-3 | Molecular Weight | 478.200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C22H23Br2P | Melting Point | 210-213 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | (4-Bromobutyl)triphenylphosphonium bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 210-213 °C(lit.) |
|---|
| Molecular Formula | C22H23Br2P |
|---|
| Molecular Weight | 478.200 |
|---|
| Exact Mass | 475.990387 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 2.15960 |
|---|
| InChIKey | BJDNCJGRAMGIRU-UHFFFAOYSA-M |
|---|
| SMILES | BrCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| (4-Bromobutyl)(triphenyl)phosphonium bromide |
| 4-bromobutyl(triphenyl)phosphanium,bromide |
| Phosphonium, (4-bromobutyl)triphenyl-, bromide (1:1) |
| MFCD00031636 |
