Introduction：Basic information about CAS 55708-65-1|4-ethenyl-2-methoxy-1-phenylmethoxybenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-ethenyl-2-methoxy-1-phenylmethoxybenzene |
|---|
| CAS Number | 55708-65-1 | Molecular Weight | 240.29700 |
|---|
| Density | 1.072g/cm3 | Boiling Point | 371.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O2 | Melting Point | 49-54ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | >230 °F |
|---|
Names
| Name | 4-ethenyl-2-methoxy-1-phenylmethoxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.072g/cm3 |
|---|
| Boiling Point | 371.3ºC at 760 mmHg |
|---|
| Melting Point | 49-54ºC(lit.) |
|---|
| Molecular Formula | C16H16O2 |
|---|
| Molecular Weight | 240.29700 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 240.11500 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.91720 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | DPAUCHAAEWIRKG-UHFFFAOYSA-N |
|---|
| SMILES | C=Cc1ccc(OCc2ccccc2)c(OC)c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-Benzyloxy-3-methoxystyrene |
| EINECS 259-771-9 |
| 4-benzyloxy-3-methoxy-1-ethenylbenzene |
| MFCD00008616 |
| 2-Benzyloxy-5-vinylanisole |
| 1-benzyloxy-2-methoxy-4-vinylbenzene |
| 4-ethenyl-2-methoxy-1-benzyloxybenzene |
