Introduction:Basic information about CAS 1504-63-8|4-Nitrocinnamyl alcohol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrocinnamyl alcohol |
|---|
| CAS Number | 1504-63-8 | Molecular Weight | 179.173 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 325.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO3 | Melting Point | 127-128 °C(lit.) |
|---|
| MSDS | / | Flash Point | 144.0±10.8 °C |
|---|
Names
| Name | 4-nitrocinnamyl alcohol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 325.3±22.0 °C at 760 mmHg |
|---|
| Melting Point | 127-128 °C(lit.) |
|---|
| Molecular Formula | C9H9NO3 |
|---|
| Molecular Weight | 179.173 |
|---|
| Flash Point | 144.0±10.8 °C |
|---|
| Exact Mass | 179.058243 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 1.48 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | LGXXEDSIJZHDBN-OWOJBTEDSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(C=CCO)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 4-Nitrociamyl alcohol |
| p-Nitrocinnamyl alcohol |
| MFCD00017045 |
| (2E)-3-(4-Nitrophenyl)-2-propen-1-ol |
| 2-Propen-1-ol, 3-(p-nitrophenyl)- |
| (2E)-3-(4-nitrophenyl)prop-2-en-1-ol |
| 4-Nitrozimtalkohol |
| 2-Propen-1-ol, 3-(4-nitrophenyl)- |
| 4-Nitrocinnamyl alcohol |
| 2-Propen-1-ol, 3-(4-nitrophenyl)-, (2E)- |