Introduction：Basic information about CAS 73013-77-1|2-[[4-[(2-cyanoethyl)(2-phenoxyethyl)amino]phenyl]azo]-5-nitrobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[4-[(2-cyanoethyl)(2-phenoxyethyl)amino]phenyl]azo]-5-nitrobenzonitrile |
|---|
| CAS Number | 73013-77-1 | Molecular Weight | 440.45400 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 703.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H20N6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 379.5ºC |
|---|
Names
| Name | 2-[[4-[2-cyanoethyl(2-phenoxyethyl)amino]phenyl]diazenyl]-5-nitrobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 703.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H20N6O3 |
|---|
| Molecular Weight | 440.45400 |
|---|
| Flash Point | 379.5ºC |
|---|
| Exact Mass | 440.16000 |
|---|
| PSA | 130.59000 |
|---|
| LogP | 6.20416 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | DRTTUVOUBWLRPF-UHFFFAOYSA-N |
|---|
| SMILES | N#CCCN(CCOc1ccccc1)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2C#N)cc1 |
|---|
Synonyms
| Benzonitrile,2-[[4-[(2-cyanoethyl)(2-phenoxyethyl)amino]phenyl]azo]-5-nitro-(9CI) |
| Benzonitrile,2-[2-[4-[(2-cyanoethyl)(2-phenoxyethyl)amino]phenyl]diazenyl]-5-nitro |
| 2-((4-((2-Cyanoethyl)(2-phenoxyethyl)amino)phenyl)azo)-5-nitrobenzonitrile |
| EINECS 277-216-9 |
