Introduction：Basic information about CAS 73120-67-9|4-(4-isobutylphenyl)-4-oxobutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-isobutylphenyl)-4-oxobutanoic acid |
|---|
| CAS Number | 73120-67-9 | Molecular Weight | 234.29100 |
|---|
| Density | 1.09g/cm3 | Boiling Point | 412ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.1ºC |
|---|
Names
| Name | 4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.09g/cm3 |
|---|
| Boiling Point | 412ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O3 |
|---|
| Molecular Weight | 234.29100 |
|---|
| Flash Point | 217.1ºC |
|---|
| Exact Mass | 234.12600 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.93260 |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | VTSCHNAWJCRJJG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Cc1ccc(C(=O)CCC(=O)O)cc1 |
|---|
Synonyms
| 3-(4-isobutylbenzoyl)propionic acid |
| 4-(4-isobutylphenyl)-4-oxobutanoic acid |
| 4-oxo-4-(2'-methylpropyl)phenylbutanoic acid |
