Introduction:Basic information about CAS 38943-76-9|3-Dechloro-4-chloro Lamotrigine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Dechloro-4-chloro Lamotrigine |
|---|
| CAS Number | 38943-76-9 | Molecular Weight | 256.09100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H7Cl2N5 | Melting Point | 230-232°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 230-232°C |
|---|
| Molecular Formula | C9H7Cl2N5 |
|---|
| Molecular Weight | 256.09100 |
|---|
| Exact Mass | 255.00800 |
|---|
| PSA | 91.44000 |
|---|
| LogP | 2.52110 |
|---|
| InChIKey | HHXRWOXSGOMXJV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nnc(-c2ccc(Cl)cc2Cl)c(N)n1 |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 6-(2,4-dichloro-phenyl)-[1,2,4]triazine-3,5-diyldiamine |
| 6-(2,4-Dichlor-phenyl)-[1,2,4]triazin-3,5-diyldiamin |
| Lamotrigine specified impurity G [EP] |
| 6-(2,4-dichloro-phenyl)-[1,2,4]triazine-3,5-diamine |
| As-triazine,3,5-diamino-6-(2,4-dichlorophenyl) |
| 1,2,4-Triazine-3,5-diamine,6-(2,4-dichlorophenyl) |
| 3-Dechloro-4-chloro Lamotrigine |
| 3,5-diamino-6-(2,4-dichlorophenyl)-1,2,4-triazine |
| Lamotrigine Impurity 6 |