Introduction：Basic information about CAS 55593-53-8|(S)-(+)-2-METHYLBUTYL 4-(4-DECYLOXYBENZ&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(+)-2-METHYLBUTYL 4-(4-DECYLOXYBENZ& |
|---|
| CAS Number | 55593-53-8 | Molecular Weight | 477.67800 |
|---|
| Density | 0.98g/cm3 | Boiling Point | 600.1ºC at 760 mmHg |
|---|
| Molecular Formula | C31H43NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.5ºC |
|---|
Names
| Name | 2-methylbutyl 3-[4-[(4-decoxyphenyl)methylideneamino]phenyl]prop-2-enoate |
|---|
Chemical & Physical Properties
| Density | 0.98g/cm3 |
|---|
| Boiling Point | 600.1ºC at 760 mmHg |
|---|
| Molecular Formula | C31H43NO3 |
|---|
| Molecular Weight | 477.67800 |
|---|
| Flash Point | 173.5ºC |
|---|
| Exact Mass | 477.32400 |
|---|
| PSA | 47.89000 |
|---|
| LogP | 8.55920 |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | UTIMESSLYFMSPO-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCCOc1ccc(C=Nc2ccc(C=CC(=O)OCC(C)CC)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-28-36 |
|---|
