Introduction:Basic information about CAS 26389-78-6|CHLORNIDINE), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | CHLORNIDINE) |
|---|
| CAS Number | 26389-78-6 | Molecular Weight | 322.14500 |
|---|
| Density | 1.443g/cm3 | Boiling Point | 465.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H13Cl2N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.5ºC |
|---|
Names
| Name | chlornidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.443g/cm3 |
|---|
| Boiling Point | 465.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H13Cl2N3O4 |
|---|
| Molecular Weight | 322.14500 |
|---|
| Flash Point | 235.5ºC |
|---|
| Exact Mass | 321.02800 |
|---|
| PSA | 94.88000 |
|---|
| LogP | 4.14180 |
|---|
| Vapour Pressure | 7.45E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | XKUWFOYPQIVFMM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])c(N(CCCl)CCCl)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N,N-bis(2-chloroethyl)-2,6-dinitro-p-toluidine |
| N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitroaniline |
| 2,6-dinitro-N,N-di(2-chloroethyl)-p-toluidine |
| Torpedo |
| 4-methyl-2,6-dinitro-N,N-bis(2-chloroethyl)aniline |
| N,N-Bis(2-chloroethyl)-2,6-dinitro-p-toluidine |
| CHLORNIDINE |
| N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitrobenzenamine |
| Benzenamine,N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitro |
| N-N-Bis-chloroethyl-2,6-dinitro-p-toluidin |
| Caswell No. 089A |